C29H41BrN2O11 — CID 71314343
tert-butyl 2-[1-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-yl]piperidine-1-carboxylate bromide (PubChem CID 71314343) has the molecular formula C29H41BrN2O11 and a molecular weight of 673.55 g/mol. Its IUPAC name is tert-butyl 2-[1-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-yl]piperidine-1-carboxylate bromide.
| Compound Name | tert-butyl 2-[1-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-yl]piperidine-1-carboxylate bromide |
|---|---|
| PubChem CID | 71314343 |
| Molecular Formula | C29H41BrN2O11 |
| Molecular Weight | 673.55 g/mol |
| Exact Mass | 672.19 |
| IUPAC Name | tert-butyl 2-[1-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-yl]piperidine-1-carboxylate bromide |
| SMILES | CC(=O)OC[C@H]1OC([n+]2cccc(C3CCCCN3C(=O)OC(C)(C)C)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O.[Br-] |
| InChI | InChI=1S/C29H41N2O11.BrH/c1-17(32)37-16-23-24(38-18(2)33)25(39-19(3)34)26(40-20(4)35)27(41-23)30-13-10-11-21(15-30)22-12-8-9-14-31(22)28(36)42-29(5,6)7;/h10-11,13,15,22-27H,8-9,12,14,16H2,1-7H3;1H/q+1;/p-1/t22?,23-,24-,25+,26-,27?;/m1./s1 |
| InChIKey | HFCNMSATWGOWHM-LQLADCSOSA-M |
| XLogP | -0.30 |
| TPSA | 147.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.55 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|