C19H29NO9S — CID 87897419
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-piperidin-1-ylsulfanyloxan-2-yl]methyl acetate (PubChem CID 87897419) has the molecular formula C19H29NO9S and a molecular weight of 447.51 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-piperidin-1-ylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-piperidin-1-ylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87897419 |
| Molecular Formula | C19H29NO9S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-piperidin-1-ylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SN2CCCCC2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H29NO9S/c1-11(21)25-10-15-16(26-12(2)22)17(27-13(3)23)18(28-14(4)24)19(29-15)30-20-8-6-5-7-9-20/h15-19H,5-10H2,1-4H3/t15-,16+,17+,18-,19+/m1/s1 |
| InChIKey | JAANCVGNWDNVLH-SPOLIRPYSA-N |
| XLogP | 1.20 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|