C16H24O9S2 — CID 134975100
[(3R,6S)-3,4,5-triacetyloxy-6-(ethyldisulfanyl)oxan-2-yl]methyl acetate (PubChem CID 134975100) has the molecular formula C16H24O9S2 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(3R,6S)-3,4,5-triacetyloxy-6-(ethyldisulfanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4,5-triacetyloxy-6-(ethyldisulfanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134975100 |
| Molecular Formula | C16H24O9S2 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [(3R,6S)-3,4,5-triacetyloxy-6-(ethyldisulfanyl)oxan-2-yl]methyl acetate |
| SMILES | CCSS[C@@H]1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C16H24O9S2/c1-6-26-27-16-15(24-11(5)20)14(23-10(4)19)13(22-9(3)18)12(25-16)7-21-8(2)17/h12-16H,6-7H2,1-5H3/t12?,13-,14?,15?,16+/m1/s1 |
| InChIKey | QMGVROKGZJDDRR-LXOMYOHXSA-N |
| XLogP | 1.47 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|