C17H26O9S2 — CID 102046020
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(propyldisulfanyl)oxan-2-yl]methyl acetate (PubChem CID 102046020) has the molecular formula C17H26O9S2 and a molecular weight of 438.52 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(propyldisulfanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(propyldisulfanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102046020 |
| Molecular Formula | C17H26O9S2 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(propyldisulfanyl)oxan-2-yl]methyl acetate |
| SMILES | CCCSS[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H26O9S2/c1-6-7-27-28-17-16(25-12(5)21)15(24-11(4)20)14(23-10(3)19)13(26-17)8-22-9(2)18/h13-17H,6-8H2,1-5H3/t13-,14-,15+,16-,17+/m1/s1 |
| InChIKey | DGATXJYJMGLRLS-UUAJXVIYSA-N |
| XLogP | 1.86 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|