C30H53NO9S — CID 134927780
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(dioctylamino)sulfanyloxan-2-yl]methyl acetate (PubChem CID 134927780) has the molecular formula C30H53NO9S and a molecular weight of 603.82 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(dioctylamino)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(dioctylamino)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134927780 |
| Molecular Formula | C30H53NO9S |
| Molecular Weight | 603.82 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(dioctylamino)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CCCCCCCCN(CCCCCCCC)S[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H53NO9S/c1-7-9-11-13-15-17-19-31(20-18-16-14-12-10-8-2)41-30-29(39-25(6)35)28(38-24(5)34)27(37-23(4)33)26(40-30)21-36-22(3)32/h26-30H,7-21H2,1-6H3/t26-,27+,28+,29-,30+/m1/s1 |
| InChIKey | VWTLXBZWVSVWAG-QBHLCAJUSA-N |
| XLogP | 5.74 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.82 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|