C27H44O9S — CID 11858978
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(E)-tridec-2-enyl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 11858978) has the molecular formula C27H44O9S and a molecular weight of 544.71 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(E)-tridec-2-enyl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(E)-tridec-2-enyl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11858978 |
| Molecular Formula | C27H44O9S |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(E)-tridec-2-enyl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CCCCCCCCCC/C=C/CS[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H44O9S/c1-6-7-8-9-10-11-12-13-14-15-16-17-37-27-26(35-22(5)31)25(34-21(4)30)24(33-20(3)29)23(36-27)18-32-19(2)28/h15-16,23-27H,6-14,17-18H2,1-5H3/b16-15+/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | IGNPGQSTBMLBNB-TZGBXIPCSA-N |
| XLogP | 4.89 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|