C23H36O10 — CID 10939648
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-non-2-enoxy]oxan-2-yl]methyl acetate (PubChem CID 10939648) has the molecular formula C23H36O10 and a molecular weight of 472.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-non-2-enoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-non-2-enoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10939648 |
| Molecular Formula | C23H36O10 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-non-2-enoxy]oxan-2-yl]methyl acetate |
| SMILES | CCCCCC/C=C/CO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H36O10/c1-6-7-8-9-10-11-12-13-28-23-22(32-18(5)27)21(31-17(4)26)20(30-16(3)25)19(33-23)14-29-15(2)24/h11-12,19-23H,6-10,13-14H2,1-5H3/b12-11+/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | MRNOVDUWSDAQRL-WXONXQOXSA-N |
| XLogP | 2.61 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|