C21H30O12 — CID 101035544
methyl (Z)-6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyhex-4-enoate (PubChem CID 101035544) has the molecular formula C21H30O12 and a molecular weight of 474.46 g/mol. Its IUPAC name is methyl (Z)-6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyhex-4-enoate.
| Compound Name | methyl (Z)-6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyhex-4-enoate |
|---|---|
| PubChem CID | 101035544 |
| Molecular Formula | C21H30O12 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | methyl (Z)-6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyhex-4-enoate |
| SMILES | COC(=O)CC/C=C\CO[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H30O12/c1-12(22)29-11-16-18(30-13(2)23)19(31-14(3)24)20(32-15(4)25)21(33-16)28-10-8-6-7-9-17(26)27-5/h6,8,16,18-21H,7,9-11H2,1-5H3/b8-6-/t16-,18-,19+,20-,21+/m1/s1 |
| InChIKey | QNHLODJGUGGSGU-SSZJLIHXSA-N |
| XLogP | 0.60 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|