C30H52O7S — CID 70572110
[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-2-methyl-6-[(Z)-octadec-9-enyl]sulfanyloxan-3-yl] acetate (PubChem CID 70572110) has the molecular formula C30H52O7S and a molecular weight of 556.81 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-2-methyl-6-[(Z)-octadec-9-enyl]sulfanyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-2-methyl-6-[(Z)-octadec-9-enyl]sulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 70572110 |
| Molecular Formula | C30H52O7S |
| Molecular Weight | 556.81 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-2-methyl-6-[(Z)-octadec-9-enyl]sulfanyloxan-3-yl] acetate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCS[C@H]1O[C@@H](C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H52O7S/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-38-30-29(37-26(5)33)28(36-25(4)32)27(23(2)34-30)35-24(3)31/h13-14,23,27-30H,6-12,15-22H2,1-5H3/b14-13-/t23-,27+,28+,29-,30+/m0/s1 |
| InChIKey | XXUFLUMWHJOKRD-DRCIQHJVSA-N |
| XLogP | 7.30 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.81 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|