C15H22O9S — CID 22823286
3-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]sulfanylpropanoic acid (PubChem CID 22823286) has the molecular formula C15H22O9S and a molecular weight of 378.40 g/mol. Its IUPAC name is 3-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]sulfanylpropanoic acid.
| Compound Name | 3-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 22823286 |
| Molecular Formula | C15H22O9S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]sulfanylpropanoic acid |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](C)O[C@H](SCCC(=O)O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H22O9S/c1-7-12(22-8(2)16)13(23-9(3)17)14(24-10(4)18)15(21-7)25-6-5-11(19)20/h7,12-15H,5-6H2,1-4H3,(H,19,20)/t7-,12+,13+,14-,15+/m0/s1 |
| InChIKey | RIJQJBDOIUEOIC-LWTVUGOZSA-N |
| XLogP | 0.73 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|