C15H24O7S — CID 170092418
3-[(2S,3R,4R,5R,6R)-5-acetyloxy-6-(acetyloxymethyl)-3,4-dimethyloxan-2-yl]sulfanylpropanoic acid (PubChem CID 170092418) has the molecular formula C15H24O7S and a molecular weight of 348.42 g/mol. Its IUPAC name is 3-[(2S,3R,4R,5R,6R)-5-acetyloxy-6-(acetyloxymethyl)-3,4-dimethyloxan-2-yl]sulfanylpropanoic acid.
| Compound Name | 3-[(2S,3R,4R,5R,6R)-5-acetyloxy-6-(acetyloxymethyl)-3,4-dimethyloxan-2-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 170092418 |
| Molecular Formula | C15H24O7S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-[(2S,3R,4R,5R,6R)-5-acetyloxy-6-(acetyloxymethyl)-3,4-dimethyloxan-2-yl]sulfanylpropanoic acid |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCCC(=O)O)[C@H](C)[C@@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H24O7S/c1-8-9(2)15(23-6-5-13(18)19)22-12(7-20-10(3)16)14(8)21-11(4)17/h8-9,12,14-15H,5-7H2,1-4H3,(H,18,19)/t8-,9-,12-,14-,15+/m1/s1 |
| InChIKey | DDQWRSADJAIVPK-TUPNWWJUSA-N |
| XLogP | 1.69 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |