C36H52O20S2 — CID 73056879
6,8-bis[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl]octanoic acid (PubChem CID 73056879) has the molecular formula C36H52O20S2 and a molecular weight of 868.93 g/mol. Its IUPAC name is 6,8-bis[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl]octanoic acid.
| Compound Name | 6,8-bis[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl]octanoic acid |
|---|---|
| PubChem CID | 73056879 |
| Molecular Formula | C36H52O20S2 |
| Molecular Weight | 868.93 g/mol |
| Exact Mass | 868.25 |
| IUPAC Name | 6,8-bis[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl]octanoic acid |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCCC(CCCCC(=O)O)S[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C36H52O20S2/c1-17(37)47-15-26-29(49-19(3)39)31(51-21(5)41)33(53-23(7)43)35(55-26)57-14-13-25(11-9-10-12-28(45)46)58-36-34(54-24(8)44)32(52-22(6)42)30(50-20(4)40)27(56-36)16-48-18(2)38/h25-27,29-36H,9-16H2,1-8H3,(H,45,46)/t25?,26-,27-,29-,30-,31+,32+,33-,34-,35+,36+/m1/s1 |
| InChIKey | NDCLLDRNNYVJFK-CKNFJXPHSA-N |
| XLogP | 2.02 |
| TPSA | 266.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.93 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|