C16H22O11S — CID 132577465
2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylacetic acid (PubChem CID 132577465) has the molecular formula C16H22O11S and a molecular weight of 422.41 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylacetic acid.
| Compound Name | 2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 132577465 |
| Molecular Formula | C16H22O11S |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylacetic acid |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCC(=O)O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H22O11S/c1-7(17)23-5-11-13(24-8(2)18)14(25-9(3)19)15(26-10(4)20)16(27-11)28-6-12(21)22/h11,13-16H,5-6H2,1-4H3,(H,21,22)/t11-,13-,14+,15+,16+/m1/s1 |
| InChIKey | JRBJUJMGVZJRDN-VMMWWAARSA-N |
| XLogP | -0.11 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|