C14H20O10S — CID 11501776
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxysulfanyloxan-2-yl]methyl acetate (PubChem CID 11501776) has the molecular formula C14H20O10S and a molecular weight of 380.37 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxysulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxysulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11501776 |
| Molecular Formula | C14H20O10S |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxysulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SO)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H20O10S/c1-6(15)20-5-10-11(21-7(2)16)12(22-8(3)17)13(23-9(4)18)14(24-10)25-19/h10-14,19H,5H2,1-4H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | TWGVCDJQVFYJJR-RGDJUOJXSA-N |
| XLogP | 0.28 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|