C15H22O11S2 — CID 22340264
(3,4,5-triacetyloxy-6-methylsulfonylsulfanyloxan-2-yl)methyl acetate (PubChem CID 22340264) has the molecular formula C15H22O11S2 and a molecular weight of 442.46 g/mol. Its IUPAC name is (3,4,5-triacetyloxy-6-methylsulfonylsulfanyloxan-2-yl)methyl acetate.
| Compound Name | (3,4,5-triacetyloxy-6-methylsulfonylsulfanyloxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 22340264 |
| Molecular Formula | C15H22O11S2 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | (3,4,5-triacetyloxy-6-methylsulfonylsulfanyloxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(SS(C)(=O)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C15H22O11S2/c1-7(16)22-6-11-12(23-8(2)17)13(24-9(3)18)14(25-10(4)19)15(26-11)27-28(5,20)21/h11-15H,6H2,1-5H3 |
| InChIKey | IQLJSXWXOFAZAS-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|