C21H28O7S — CID 145129125
[(3R,6R)-3,5-diacetyloxy-4-methyl-6-(2-phenylethylsulfanyl)oxan-2-yl]methyl acetate (PubChem CID 145129125) has the molecular formula C21H28O7S and a molecular weight of 424.52 g/mol. Its IUPAC name is [(3R,6R)-3,5-diacetyloxy-4-methyl-6-(2-phenylethylsulfanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,5-diacetyloxy-4-methyl-6-(2-phenylethylsulfanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 145129125 |
| Molecular Formula | C21H28O7S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [(3R,6R)-3,5-diacetyloxy-4-methyl-6-(2-phenylethylsulfanyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](SCCc2ccccc2)C(OC(C)=O)C(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H28O7S/c1-13-19(26-15(3)23)18(12-25-14(2)22)28-21(20(13)27-16(4)24)29-11-10-17-8-6-5-7-9-17/h5-9,13,18-21H,10-12H2,1-4H3/t13?,18?,19-,20?,21-/m1/s1 |
| InChIKey | NTRURFRMKVVBJN-GPGUURKWSA-N |
| XLogP | 2.75 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|