C19H24ClN3O5S — CID 149390549
[(3R,4R,6R)-3-acetyloxy-4-azido-6-[2-(2-chlorophenyl)ethylsulfanyl]-5-methyloxan-2-yl]methyl acetate (PubChem CID 149390549) has the molecular formula C19H24ClN3O5S and a molecular weight of 441.94 g/mol. Its IUPAC name is [(3R,4R,6R)-3-acetyloxy-4-azido-6-[2-(2-chlorophenyl)ethylsulfanyl]-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R,6R)-3-acetyloxy-4-azido-6-[2-(2-chlorophenyl)ethylsulfanyl]-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 149390549 |
| Molecular Formula | C19H24ClN3O5S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | [(3R,4R,6R)-3-acetyloxy-4-azido-6-[2-(2-chlorophenyl)ethylsulfanyl]-5-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](SCCc2ccccc2Cl)C(C)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H24ClN3O5S/c1-11-17(22-23-21)18(27-13(3)25)16(10-26-12(2)24)28-19(11)29-9-8-14-6-4-5-7-15(14)20/h4-7,11,16-19H,8-10H2,1-3H3/t11?,16?,17-,18+,19-/m1/s1 |
| InChIKey | YNLBAYFVQPDERW-TWFYHJSMSA-N |
| XLogP | 4.15 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|