C17H18Cl2FN3O5S — CID 147853349
[(3R,4R,6R)-3-acetyloxy-4-azido-6-(4,5-dichloro-2-fluorophenyl)sulfanyl-5-methyloxan-2-yl]methyl acetate (PubChem CID 147853349) has the molecular formula C17H18Cl2FN3O5S and a molecular weight of 466.32 g/mol. Its IUPAC name is [(3R,4R,6R)-3-acetyloxy-4-azido-6-(4,5-dichloro-2-fluorophenyl)sulfanyl-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R,6R)-3-acetyloxy-4-azido-6-(4,5-dichloro-2-fluorophenyl)sulfanyl-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 147853349 |
| Molecular Formula | C17H18Cl2FN3O5S |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | [(3R,4R,6R)-3-acetyloxy-4-azido-6-(4,5-dichloro-2-fluorophenyl)sulfanyl-5-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2cc(Cl)c(Cl)cc2F)C(C)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H18Cl2FN3O5S/c1-7-15(22-23-21)16(27-9(3)25)13(6-26-8(2)24)28-17(7)29-14-5-11(19)10(18)4-12(14)20/h4-5,7,13,15-17H,6H2,1-3H3/t7?,13?,15-,16+,17-/m1/s1 |
| InChIKey | HVGDFGNVBKAXGV-DMUSXDMLSA-N |
| XLogP | 4.76 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|