C17H18Br2N4O7S — CID 166587004
[(3R,5S,6R)-3,5-diacetyloxy-4-azido-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 166587004) has the molecular formula C17H18Br2N4O7S and a molecular weight of 582.23 g/mol. Its IUPAC name is [(3R,5S,6R)-3,5-diacetyloxy-4-azido-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,5S,6R)-3,5-diacetyloxy-4-azido-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 166587004 |
| Molecular Formula | C17H18Br2N4O7S |
| Molecular Weight | 582.23 g/mol |
| Exact Mass | 579.93 |
| IUPAC Name | [(3R,5S,6R)-3,5-diacetyloxy-4-azido-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2cc(Br)cnc2Br)[C@@H](OC(C)=O)C(N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H18Br2N4O7S/c1-7(24)27-6-11-14(28-8(2)25)13(22-23-20)15(29-9(3)26)17(30-11)31-12-4-10(18)5-21-16(12)19/h4-5,11,13-15,17H,6H2,1-3H3/t11?,13?,14-,15-,17+/m0/s1 |
| InChIKey | BDAXQJYTJXMESD-WJXKHETQSA-N |
| XLogP | 3.53 |
| TPSA | 149.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|