C21H37N3O7SSi — CID 140942870
[(2R,3R,4S,5R,6S)-3,5-diacetyloxy-4-azido-6-tri(propan-2-yl)silylsulfanyloxan-2-yl]methyl acetate (PubChem CID 140942870) has the molecular formula C21H37N3O7SSi and a molecular weight of 503.69 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-4-azido-6-tri(propan-2-yl)silylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-4-azido-6-tri(propan-2-yl)silylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 140942870 |
| Molecular Formula | C21H37N3O7SSi |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-4-azido-6-tri(propan-2-yl)silylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S[Si](C(C)C)(C(C)C)C(C)C)[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H37N3O7SSi/c1-11(2)33(12(3)4,13(5)6)32-21-20(30-16(9)27)18(23-24-22)19(29-15(8)26)17(31-21)10-28-14(7)25/h11-13,17-21H,10H2,1-9H3/t17-,18+,19+,20-,21+/m1/s1 |
| InChIKey | MYXXFVQNCGONAG-IFLJBQAJSA-N |
| XLogP | 4.73 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|