C13H19BrN4O8S — CID 175223035
[(2R,3R,4S,5R,6S)-3,5-diacetyloxy-4-azido-6-formamidosulfanyloxan-2-yl]methyl acetate;hydrobromide (PubChem CID 175223035) has the molecular formula C13H19BrN4O8S and a molecular weight of 471.29 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-4-azido-6-formamidosulfanyloxan-2-yl]methyl acetate;hydrobromide.
| Compound Name | [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-4-azido-6-formamidosulfanyloxan-2-yl]methyl acetate;hydrobromide |
|---|---|
| PubChem CID | 175223035 |
| Molecular Formula | C13H19BrN4O8S |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-4-azido-6-formamidosulfanyloxan-2-yl]methyl acetate;hydrobromide |
| SMILES | Br.CC(=O)OC[C@H]1O[C@@H](SNC=O)[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H18N4O8S.BrH/c1-6(19)22-4-9-11(23-7(2)20)10(16-17-14)12(24-8(3)21)13(25-9)26-15-5-18;/h5,9-13H,4H2,1-3H3,(H,15,18);1H/t9-,10+,11+,12-,13+;/m1./s1 |
| InChIKey | PJRMBUQYFLPBBC-SGMIJDKTSA-N |
| XLogP | 0.79 |
| TPSA | 165.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|