C13H21N3O5S — CID 90700770
[(4R,6S)-4-acetyloxy-3-azido-6-ethylsulfanyl-5-methyloxan-2-yl]methyl acetate (PubChem CID 90700770) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is [(4R,6S)-4-acetyloxy-3-azido-6-ethylsulfanyl-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(4R,6S)-4-acetyloxy-3-azido-6-ethylsulfanyl-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90700770 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [(4R,6S)-4-acetyloxy-3-azido-6-ethylsulfanyl-5-methyloxan-2-yl]methyl acetate |
| SMILES | CCS[C@@H]1OC(COC(C)=O)C(N=[N+]=[N-])[C@H](OC(C)=O)C1C |
| InChI | InChI=1S/C13H21N3O5S/c1-5-22-13-7(2)12(20-9(4)18)11(15-16-14)10(21-13)6-19-8(3)17/h7,10-13H,5-6H2,1-4H3/t7?,10?,11?,12-,13+/m1/s1 |
| InChIKey | YBIMQTSLQNAVGN-OSFFWZEASA-N |
| XLogP | 2.27 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|