C18H22ClN3O5S — CID 159444331
[(3R,4R,6R)-3-acetyloxy-4-azido-6-[(4-chlorophenyl)methylsulfanyl]-5-methyloxan-2-yl]methyl acetate (PubChem CID 159444331) has the molecular formula C18H22ClN3O5S and a molecular weight of 427.91 g/mol. Its IUPAC name is [(3R,4R,6R)-3-acetyloxy-4-azido-6-[(4-chlorophenyl)methylsulfanyl]-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R,6R)-3-acetyloxy-4-azido-6-[(4-chlorophenyl)methylsulfanyl]-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 159444331 |
| Molecular Formula | C18H22ClN3O5S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | [(3R,4R,6R)-3-acetyloxy-4-azido-6-[(4-chlorophenyl)methylsulfanyl]-5-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](SCc2ccc(Cl)cc2)C(C)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H22ClN3O5S/c1-10-16(21-22-20)17(26-12(3)24)15(8-25-11(2)23)27-18(10)28-9-13-4-6-14(19)7-5-13/h4-7,10,15-18H,8-9H2,1-3H3/t10?,15?,16-,17+,18-/m1/s1 |
| InChIKey | LSOPGARONDJWCA-BGQVSKGASA-N |
| XLogP | 4.11 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|