C19H21Cl2N3O7S — CID 122443420
[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(3,4-dichlorophenyl)methylsulfanyl]oxan-2-yl]methyl acetate (PubChem CID 122443420) has the molecular formula C19H21Cl2N3O7S and a molecular weight of 506.36 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(3,4-dichlorophenyl)methylsulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(3,4-dichlorophenyl)methylsulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122443420 |
| Molecular Formula | C19H21Cl2N3O7S |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(3,4-dichlorophenyl)methylsulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](SCc2ccc(Cl)c(Cl)c2)[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H21Cl2N3O7S/c1-9(25)28-7-15-17(29-10(2)26)16(23-24-22)18(30-11(3)27)19(31-15)32-8-12-4-5-13(20)14(21)6-12/h4-6,15-19H,7-8H2,1-3H3/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | XOFGXLMSOYNVGV-ICBNADEASA-N |
| XLogP | 4.06 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|