C17H19BrN4O7S — CID 122443372
[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 122443372) has the molecular formula C17H19BrN4O7S and a molecular weight of 503.33 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122443372 |
| Molecular Formula | C17H19BrN4O7S |
| Molecular Weight | 503.33 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Sc2cncc(Br)c2)[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H19BrN4O7S/c1-8(23)26-7-13-15(27-9(2)24)14(21-22-19)16(28-10(3)25)17(29-13)30-12-4-11(18)5-20-6-12/h4-6,13-17H,7H2,1-3H3/t13-,14+,15+,16-,17-/m1/s1 |
| InChIKey | DBXMNAKGZKAKNP-DRRXZNNHSA-N |
| XLogP | 2.77 |
| TPSA | 149.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|