C17H18BrF3N4O5S — CID 161027448
[(3R,5S,6R)-5-acetyloxy-4-azido-6-[[5-bromo-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-3-methyloxan-2-yl]methyl acetate (PubChem CID 161027448) has the molecular formula C17H18BrF3N4O5S and a molecular weight of 527.32 g/mol. Its IUPAC name is [(3R,5S,6R)-5-acetyloxy-4-azido-6-[[5-bromo-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-3-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,5S,6R)-5-acetyloxy-4-azido-6-[[5-bromo-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-3-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 161027448 |
| Molecular Formula | C17H18BrF3N4O5S |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 526.01 |
| IUPAC Name | [(3R,5S,6R)-5-acetyloxy-4-azido-6-[[5-bromo-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-3-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2cnc(C(F)(F)F)c(Br)c2)[C@@H](OC(C)=O)C(N=[N+]=[N-])[C@H]1C |
| InChI | InChI=1S/C17H18BrF3N4O5S/c1-7-12(6-28-8(2)26)30-16(14(29-9(3)27)13(7)24-25-22)31-10-4-11(18)15(23-5-10)17(19,20)21/h4-5,7,12-14,16H,6H2,1-3H3/t7-,12?,13?,14-,16+/m0/s1 |
| InChIKey | TZEDYNFTLYSKFR-HMMQKDBJSA-N |
| XLogP | 4.49 |
| TPSA | 123.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|