C17H19N3O6S — CID 130471424
[(3R,5S,6S)-5-acetyloxy-4-azido-3-formyl-6-phenylsulfanyloxan-2-yl]methyl acetate (PubChem CID 130471424) has the molecular formula C17H19N3O6S and a molecular weight of 393.42 g/mol. Its IUPAC name is [(3R,5S,6S)-5-acetyloxy-4-azido-3-formyl-6-phenylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,5S,6S)-5-acetyloxy-4-azido-3-formyl-6-phenylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 130471424 |
| Molecular Formula | C17H19N3O6S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [(3R,5S,6S)-5-acetyloxy-4-azido-3-formyl-6-phenylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Sc2ccccc2)[C@@H](OC(C)=O)C(N=[N+]=[N-])[C@H]1C=O |
| InChI | InChI=1S/C17H19N3O6S/c1-10(22)24-9-14-13(8-21)15(19-20-18)16(25-11(2)23)17(26-14)27-12-6-4-3-5-7-12/h3-8,13-17H,9H2,1-2H3/t13-,14?,15?,16-,17-/m0/s1 |
| InChIKey | FNSFVRMZRNIQBW-VMAZRHSESA-N |
| XLogP | 2.49 |
| TPSA | 127.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|