C14H17N3O4S — CID 71662360
[(2R,3R,4R,5R,6S)-5-azido-4-hydroxy-2-methyl-6-phenylsulfanyloxan-3-yl] acetate (PubChem CID 71662360) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-5-azido-4-hydroxy-2-methyl-6-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-5-azido-4-hydroxy-2-methyl-6-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 71662360 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-5-azido-4-hydroxy-2-methyl-6-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](O)[C@@H](N=[N+]=[N-])[C@H](Sc2ccccc2)O[C@@H]1C |
| InChI | InChI=1S/C14H17N3O4S/c1-8-13(21-9(2)18)12(19)11(16-17-15)14(20-8)22-10-6-4-3-5-7-10/h3-8,11-14,19H,1-2H3/t8-,11-,12-,13+,14+/m1/s1 |
| InChIKey | WXUWKGOMRQYUFH-ZPTNNJSTSA-N |
| XLogP | 2.49 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|