C29H37N3O8S — CID 11330747
[(2S,3R,4S,5R,6R)-5-azido-4-methoxy-2-[(2S,3S,4R,5R,6S)-3-methoxy-2-methyl-5-phenylmethoxy-6-phenylsulfanyloxan-4-yl]oxy-6-methyloxan-3-yl] acetate (PubChem CID 11330747) has the molecular formula C29H37N3O8S and a molecular weight of 587.70 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-5-azido-4-methoxy-2-[(2S,3S,4R,5R,6S)-3-methoxy-2-methyl-5-phenylmethoxy-6-phenylsulfanyloxan-4-yl]oxy-6-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-5-azido-4-methoxy-2-[(2S,3S,4R,5R,6S)-3-methoxy-2-methyl-5-phenylmethoxy-6-phenylsulfanyloxan-4-yl]oxy-6-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 11330747 |
| Molecular Formula | C29H37N3O8S |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-5-azido-4-methoxy-2-[(2S,3S,4R,5R,6S)-3-methoxy-2-methyl-5-phenylmethoxy-6-phenylsulfanyloxan-4-yl]oxy-6-methyloxan-3-yl] acetate |
| SMILES | CO[C@@H]1[C@@H](O[C@@H]2O[C@H](C)[C@@H](N=[N+]=[N-])[C@H](OC)[C@H]2OC(C)=O)[C@@H](OCc2ccccc2)[C@H](Sc2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C29H37N3O8S/c1-17-22(31-32-30)24(35-5)26(39-19(3)33)28(37-17)40-25-23(34-4)18(2)38-29(41-21-14-10-7-11-15-21)27(25)36-16-20-12-8-6-9-13-20/h6-15,17-18,22-29H,16H2,1-5H3/t17-,18+,22-,23+,24+,25-,26-,27-,28+,29+/m1/s1 |
| InChIKey | GZNBHNLIZRNBBF-WZARXWFLSA-N |
| XLogP | 4.88 |
| TPSA | 130.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|