C35H43N3O7S — CID 134831161
(3R,6S)-3-azido-5-methoxy-2-methyl-6-[(3S,6S)-2-methyl-6-methylsulfanyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxyoxane (PubChem CID 134831161) has the molecular formula C35H43N3O7S and a molecular weight of 649.81 g/mol. Its IUPAC name is (3R,6S)-3-azido-5-methoxy-2-methyl-6-[(3S,6S)-2-methyl-6-methylsulfanyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxyoxane.
| Compound Name | (3R,6S)-3-azido-5-methoxy-2-methyl-6-[(3S,6S)-2-methyl-6-methylsulfanyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxyoxane |
|---|---|
| PubChem CID | 134831161 |
| Molecular Formula | C35H43N3O7S |
| Molecular Weight | 649.81 g/mol |
| Exact Mass | 649.28 |
| IUPAC Name | (3R,6S)-3-azido-5-methoxy-2-methyl-6-[(3S,6S)-2-methyl-6-methylsulfanyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxyoxane |
| SMILES | COC1C(OCc2ccccc2)[C@H](N=[N+]=[N-])C(C)O[C@H]1OC1C(OCc2ccccc2)[C@H](SC)OC(C)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H43N3O7S/c1-23-28(37-38-36)30(41-21-26-16-10-6-11-17-26)32(39-3)34(43-23)45-31-29(40-20-25-14-8-5-9-15-25)24(2)44-35(46-4)33(31)42-22-27-18-12-7-13-19-27/h5-19,23-24,28-35H,20-22H2,1-4H3/t23?,24?,28-,29+,30?,31?,32?,33?,34+,35+/m1/s1 |
| InChIKey | LJQORVHVJXPSKU-DWILDNGESA-N |
| XLogP | 6.67 |
| TPSA | 113.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.81 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|