C40H43N3O10 — CID 16658278
[(2S,3R,4R,5S,6S)-4-[(2S,3R,4S,5R,6R)-5-azido-3-hydroxy-6-methyl-4-phenylmethoxyoxan-2-yl]oxy-2-(4-methoxyphenoxy)-6-methyl-5-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 16658278) has the molecular formula C40H43N3O10 and a molecular weight of 725.80 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-4-[(2S,3R,4S,5R,6R)-5-azido-3-hydroxy-6-methyl-4-phenylmethoxyoxan-2-yl]oxy-2-(4-methoxyphenoxy)-6-methyl-5-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4R,5S,6S)-4-[(2S,3R,4S,5R,6R)-5-azido-3-hydroxy-6-methyl-4-phenylmethoxyoxan-2-yl]oxy-2-(4-methoxyphenoxy)-6-methyl-5-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 16658278 |
| Molecular Formula | C40H43N3O10 |
| Molecular Weight | 725.80 g/mol |
| Exact Mass | 725.29 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-4-[(2S,3R,4S,5R,6R)-5-azido-3-hydroxy-6-methyl-4-phenylmethoxyoxan-2-yl]oxy-2-(4-methoxyphenoxy)-6-methyl-5-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | COc1ccc(O[C@@H]2O[C@@H](C)[C@H](OCc3ccccc3)[C@@H](O[C@@H]3O[C@H](C)[C@@H](N=[N+]=[N-])[C@H](OCc4ccccc4)[C@H]3O)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H43N3O10/c1-25-32(42-43-41)35(48-24-28-15-9-5-10-16-28)33(44)39(49-25)53-36-34(47-23-27-13-7-4-8-14-27)26(2)50-40(51-31-21-19-30(46-3)20-22-31)37(36)52-38(45)29-17-11-6-12-18-29/h4-22,25-26,32-37,39-40,44H,23-24H2,1-3H3/t25-,26+,32-,33-,34+,35+,36-,37-,39+,40+/m1/s1 |
| InChIKey | PPDCTARBQGLEKL-IPXROZRXSA-N |
| XLogP | 6.39 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.80 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|