C38H45N3O10 — CID 159103938
[(2S,4R,5R)-5-[(2R,4S,5S)-6-(acetyloxymethyl)-3-azido-4,5-dimethyloxan-2-yl]oxy-6-ethyl-2-(4-methoxyphenoxy)-4-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 159103938) has the molecular formula C38H45N3O10 and a molecular weight of 703.79 g/mol. Its IUPAC name is [(2S,4R,5R)-5-[(2R,4S,5S)-6-(acetyloxymethyl)-3-azido-4,5-dimethyloxan-2-yl]oxy-6-ethyl-2-(4-methoxyphenoxy)-4-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,4R,5R)-5-[(2R,4S,5S)-6-(acetyloxymethyl)-3-azido-4,5-dimethyloxan-2-yl]oxy-6-ethyl-2-(4-methoxyphenoxy)-4-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 159103938 |
| Molecular Formula | C38H45N3O10 |
| Molecular Weight | 703.79 g/mol |
| Exact Mass | 703.31 |
| IUPAC Name | [(2S,4R,5R)-5-[(2R,4S,5S)-6-(acetyloxymethyl)-3-azido-4,5-dimethyloxan-2-yl]oxy-6-ethyl-2-(4-methoxyphenoxy)-4-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | CCC1O[C@@H](Oc2ccc(OC)cc2)C(OC(=O)c2ccccc2)[C@H](OCc2ccccc2)[C@@H]1O[C@H]1OC(COC(C)=O)[C@@H](C)[C@H](C)C1N=[N+]=[N-] |
| InChI | InChI=1S/C38H45N3O10/c1-6-30-33(51-37-32(40-41-39)24(3)23(2)31(49-37)22-45-25(4)42)34(46-21-26-13-9-7-10-14-26)35(50-36(43)27-15-11-8-12-16-27)38(48-30)47-29-19-17-28(44-5)18-20-29/h7-20,23-24,30-35,37-38H,6,21-22H2,1-5H3/t23-,24-,30?,31?,32?,33+,34+,35?,37+,38+/m0/s1 |
| InChIKey | LAYBHAZTACGTBO-BHCMUWJOSA-N |
| XLogP | 6.64 |
| TPSA | 156.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.79 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|