C30H37N3O7 — CID 89457548
[(3S,4S,6R)-5-azido-6-[(3S,4S)-5-benzoyloxy-2,4,6-trimethyloxan-3-yl]oxy-3,4-dimethyloxan-2-yl]methyl benzoate (PubChem CID 89457548) has the molecular formula C30H37N3O7 and a molecular weight of 551.64 g/mol. Its IUPAC name is [(3S,4S,6R)-5-azido-6-[(3S,4S)-5-benzoyloxy-2,4,6-trimethyloxan-3-yl]oxy-3,4-dimethyloxan-2-yl]methyl benzoate.
| Compound Name | [(3S,4S,6R)-5-azido-6-[(3S,4S)-5-benzoyloxy-2,4,6-trimethyloxan-3-yl]oxy-3,4-dimethyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 89457548 |
| Molecular Formula | C30H37N3O7 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | [(3S,4S,6R)-5-azido-6-[(3S,4S)-5-benzoyloxy-2,4,6-trimethyloxan-3-yl]oxy-3,4-dimethyloxan-2-yl]methyl benzoate |
| SMILES | CC1OC(C)[C@@H](O[C@H]2OC(COC(=O)c3ccccc3)[C@@H](C)[C@H](C)C2N=[N+]=[N-])[C@H](C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H37N3O7/c1-17-18(2)25(32-33-31)30(38-24(17)16-36-28(34)22-12-8-6-9-13-22)40-27-19(3)26(20(4)37-21(27)5)39-29(35)23-14-10-7-11-15-23/h6-15,17-21,24-27,30H,16H2,1-5H3/t17-,18-,19+,20?,21?,24?,25?,26?,27-,30+/m0/s1 |
| InChIKey | HHDKHKBFVPXDIR-MMRIGPCDSA-N |
| XLogP | 5.57 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|