C28H39N3O9 — CID 58242428
[(2S,4S,5R)-2-[(3R,4R,6R)-5-azido-2-ethyl-6-methoxy-4-methyloxan-3-yl]oxy-4,6-dimethyl-5-(4-oxopentanoyloxy)oxan-3-yl] benzoate (PubChem CID 58242428) has the molecular formula C28H39N3O9 and a molecular weight of 561.63 g/mol. Its IUPAC name is [(2S,4S,5R)-2-[(3R,4R,6R)-5-azido-2-ethyl-6-methoxy-4-methyloxan-3-yl]oxy-4,6-dimethyl-5-(4-oxopentanoyloxy)oxan-3-yl] benzoate.
| Compound Name | [(2S,4S,5R)-2-[(3R,4R,6R)-5-azido-2-ethyl-6-methoxy-4-methyloxan-3-yl]oxy-4,6-dimethyl-5-(4-oxopentanoyloxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 58242428 |
| Molecular Formula | C28H39N3O9 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | [(2S,4S,5R)-2-[(3R,4R,6R)-5-azido-2-ethyl-6-methoxy-4-methyloxan-3-yl]oxy-4,6-dimethyl-5-(4-oxopentanoyloxy)oxan-3-yl] benzoate |
| SMILES | CCC1O[C@@H](OC)C(N=[N+]=[N-])[C@@H](C)[C@H]1O[C@@H]1OC(C)[C@H](OC(=O)CCC(C)=O)[C@H](C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H39N3O9/c1-7-20-24(16(3)22(30-31-29)27(35-6)37-20)40-28-25(39-26(34)19-11-9-8-10-12-19)17(4)23(18(5)36-28)38-21(33)14-13-15(2)32/h8-12,16-18,20,22-25,27-28H,7,13-14H2,1-6H3/t16-,17+,18?,20?,22?,23-,24-,25?,27-,28+/m1/s1 |
| InChIKey | RBGJYRSYKYJXQY-SLESUVMCSA-N |
| XLogP | 4.36 |
| TPSA | 155.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|