C28H49N3O8Si — CID 58242452
[(2R,4S,5R)-6-acetyl-2-[(3R,4R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl] 4-oxopentanoate (PubChem CID 58242452) has the molecular formula C28H49N3O8Si and a molecular weight of 583.80 g/mol. Its IUPAC name is [(2R,4S,5R)-6-acetyl-2-[(3R,4R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2R,4S,5R)-6-acetyl-2-[(3R,4R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 58242452 |
| Molecular Formula | C28H49N3O8Si |
| Molecular Weight | 583.80 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | [(2R,4S,5R)-6-acetyl-2-[(3R,4R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl] 4-oxopentanoate |
| SMILES | CCC1O[C@@H](O[Si](C)(C)C(C)(C)C)C(N=[N+]=[N-])[C@@H](C)[C@H]1O[C@@H]1OC(C(C)=O)[C@H](C)[C@H](C)C1OC(=O)CCC(C)=O |
| InChI | InChI=1S/C28H49N3O8Si/c1-12-20-24(18(5)22(30-31-29)26(35-20)39-40(10,11)28(7,8)9)38-27-25(36-21(34)14-13-15(2)32)17(4)16(3)23(37-27)19(6)33/h16-18,20,22-27H,12-14H2,1-11H3/t16-,17+,18-,20?,22?,23?,24-,25?,26+,27+/m1/s1 |
| InChIKey | OHVITONTSXXTLG-OKJVEGGGSA-N |
| XLogP | 5.71 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.80 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|