C26H50O7Si — CID 167639301
[(2R,4S,5S)-2-[(3S,4R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4,5-dimethyloxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate (PubChem CID 167639301) has the molecular formula C26H50O7Si and a molecular weight of 502.77 g/mol. Its IUPAC name is [(2R,4S,5S)-2-[(3S,4R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4,5-dimethyloxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2R,4S,5S)-2-[(3S,4R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4,5-dimethyloxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 167639301 |
| Molecular Formula | C26H50O7Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | [(2R,4S,5S)-2-[(3S,4R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4,5-dimethyloxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CCC1O[C@H](O[C@@H]2C(CO[Si](C)(C)C(C)(C)C)O[C@H](OC)C(C)[C@H]2C)C(OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C26H50O7Si/c1-13-20-15(2)16(3)23(30-19(6)27)25(31-20)33-22-17(4)18(5)24(28-10)32-21(22)14-29-34(11,12)26(7,8)9/h15-18,20-25H,13-14H2,1-12H3/t15-,16-,17+,18?,20?,21?,22-,23?,24-,25+/m0/s1 |
| InChIKey | OXWNJNWZFZYTOQ-BFGKSYDWSA-N |
| XLogP | 5.38 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|