C27H46O15Si — CID 134837855
[(3R,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxy-6-methoxyoxan-4-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 134837855) has the molecular formula C27H46O15Si and a molecular weight of 638.74 g/mol. Its IUPAC name is [(3R,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxy-6-methoxyoxan-4-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxy-6-methoxyoxan-4-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134837855 |
| Molecular Formula | C27H46O15Si |
| Molecular Weight | 638.74 g/mol |
| Exact Mass | 638.26 |
| IUPAC Name | [(3R,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxy-6-methoxyoxan-4-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1OC(CO[Si](C)(C)C(C)(C)C)[C@H](O)C(O[C@@H]2OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C2OC(C)=O)C1O |
| InChI | InChI=1S/C27H46O15Si/c1-13(28)35-11-18-21(37-14(2)29)23(38-15(3)30)24(39-16(4)31)26(41-18)42-22-19(32)17(40-25(34-8)20(22)33)12-36-43(9,10)27(5,6)7/h17-26,32-33H,11-12H2,1-10H3/t17?,18?,19-,20?,21+,22?,23?,24?,25+,26-/m0/s1 |
| InChIKey | ZPNDFKHOINCYNT-WXCKBSPLSA-N |
| XLogP | 0.57 |
| TPSA | 191.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.74 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|