C40H46O15 — CID 100962638
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-2-methoxy-6-(trityloxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 100962638) has the molecular formula C40H46O15 and a molecular weight of 766.79 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-2-methoxy-6-(trityloxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-2-methoxy-6-(trityloxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 100962638 |
| Molecular Formula | C40H46O15 |
| Molecular Weight | 766.79 g/mol |
| Exact Mass | 766.28 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-2-methoxy-6-(trityloxymethyl)oxan-4-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](O)[C@H](O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H]1O |
| InChI | InChI=1S/C40H46O15/c1-23(41)48-21-31-34(50-24(2)42)36(51-25(3)43)37(52-26(4)44)39(54-31)55-35-32(45)30(53-38(47-5)33(35)46)22-49-40(27-15-9-6-10-16-27,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-20,30-39,45-46H,21-22H2,1-5H3/t30-,31-,32+,33-,34-,35+,36+,37-,38+,39+/m1/s1 |
| InChIKey | HZGDDYASCQBNLQ-UAFBXICISA-N |
| XLogP | 2.56 |
| TPSA | 191.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|