C23H44O9Si2 — CID 14887630
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-trimethylsilylethoxy)oxan-3-yl] acetate (PubChem CID 14887630) has the molecular formula C23H44O9Si2 and a molecular weight of 520.77 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-trimethylsilylethoxy)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-trimethylsilylethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 14887630 |
| Molecular Formula | C23H44O9Si2 |
| Molecular Weight | 520.77 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-trimethylsilylethoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OCC[Si](C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H44O9Si2/c1-15(24)29-19-18(14-28-34(10,11)23(4,5)6)32-22(27-12-13-33(7,8)9)21(31-17(3)26)20(19)30-16(2)25/h18-22H,12-14H2,1-11H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | SDTKPPGHOJDZGZ-QMCAAQAGSA-N |
| XLogP | 3.88 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.77 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|