C18H30O10Si — CID 134878488
[(2R,3S,4R,5R,6R)-2,3,5-triacetyloxy-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate (PubChem CID 134878488) has the molecular formula C18H30O10Si and a molecular weight of 434.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-2,3,5-triacetyloxy-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-2,3,5-triacetyloxy-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 134878488 |
| Molecular Formula | C18H30O10Si |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-2,3,5-triacetyloxy-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H](OCC[Si](C)(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H30O10Si/c1-10(19)24-14-15(25-11(2)20)17(23-8-9-29(5,6)7)28-18(27-13(4)22)16(14)26-12(3)21/h14-18H,8-9H2,1-7H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | BZUDWSZISDHEKX-SFFUCWETSA-N |
| XLogP | 1.38 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|