C14H21ClO8 — CID 102133393
[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(2-chloroethoxy)-2-methyloxan-3-yl] acetate (PubChem CID 102133393) has the molecular formula C14H21ClO8 and a molecular weight of 352.77 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(2-chloroethoxy)-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(2-chloroethoxy)-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 102133393 |
| Molecular Formula | C14H21ClO8 |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(2-chloroethoxy)-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@H](OCCCl)O[C@@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H21ClO8/c1-7-11(21-8(2)16)12(22-9(3)17)13(23-10(4)18)14(20-7)19-6-5-15/h7,11-14H,5-6H2,1-4H3/t7-,11+,12+,13-,14+/m0/s1 |
| InChIKey | QLADVPJMHMOHJO-AJVHJNHVSA-N |
| XLogP | 0.78 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|