C26H55FO6Si3 — CID 134937551
[(2R,3R,4S,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluorooxan-3-yl] acetate (PubChem CID 134937551) has the molecular formula C26H55FO6Si3 and a molecular weight of 566.98 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluorooxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluorooxan-3-yl] acetate |
|---|---|
| PubChem CID | 134937551 |
| Molecular Formula | C26H55FO6Si3 |
| Molecular Weight | 566.98 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluorooxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](F)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H55FO6Si3/c1-18(28)30-20-19(17-29-34(11,12)24(2,3)4)31-23(27)22(33-36(15,16)26(8,9)10)21(20)32-35(13,14)25(5,6)7/h19-23H,17H2,1-16H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | FTFSEHNYTBYUQH-ZQGJOIPISA-N |
| XLogP | 7.42 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.98 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|