C18H31NO11Si — CID 11733315
[(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-nitrooxyoxan-3-yl] acetate (PubChem CID 11733315) has the molecular formula C18H31NO11Si and a molecular weight of 465.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-nitrooxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-nitrooxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11733315 |
| Molecular Formula | C18H31NO11Si |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | [(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-nitrooxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)C(O[N+](=O)[O-])O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H31NO11Si/c1-10(20)26-14-13(9-25-31(7,8)18(4,5)6)29-17(30-19(23)24)16(28-12(3)22)15(14)27-11(2)21/h13-17H,9H2,1-8H3/t13-,14-,15+,16-,17?/m1/s1 |
| InChIKey | KEVYJOUBRKFONL-VDWCLKJHSA-N |
| XLogP | 1.74 |
| TPSA | 149.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|