C31H56O13Si2 — CID 25258188
[(1R,2R,3S,4S,5S,6R,7R,8R)-2,3,4,5-tetraacetyloxy-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-(hydroxymethyl)cyclooctyl] acetate (PubChem CID 25258188) has the molecular formula C31H56O13Si2 and a molecular weight of 692.95 g/mol. Its IUPAC name is [(1R,2R,3S,4S,5S,6R,7R,8R)-2,3,4,5-tetraacetyloxy-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-(hydroxymethyl)cyclooctyl] acetate.
| Compound Name | [(1R,2R,3S,4S,5S,6R,7R,8R)-2,3,4,5-tetraacetyloxy-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-(hydroxymethyl)cyclooctyl] acetate |
|---|---|
| PubChem CID | 25258188 |
| Molecular Formula | C31H56O13Si2 |
| Molecular Weight | 692.95 g/mol |
| Exact Mass | 692.33 |
| IUPAC Name | [(1R,2R,3S,4S,5S,6R,7R,8R)-2,3,4,5-tetraacetyloxy-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-(hydroxymethyl)cyclooctyl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H56O13Si2/c1-17(33)38-23-22(16-32)24(43-45(12,13)30(6,7)8)29(44-46(14,15)31(9,10)11)28(42-21(5)37)27(41-20(4)36)26(40-19(3)35)25(23)39-18(2)34/h22-29,32H,16H2,1-15H3/t22-,23-,24-,25-,26+,27+,28+,29+/m1/s1 |
| InChIKey | LMNAKIWODXSVFV-HUPJWCAWSA-N |
| XLogP | 4.05 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.95 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|