C18H40O3SSi2 — CID 10938043
[(1S,2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-sulfanylcyclopentyl]methanol (PubChem CID 10938043) has the molecular formula C18H40O3SSi2 and a molecular weight of 392.75 g/mol. Its IUPAC name is [(1S,2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-sulfanylcyclopentyl]methanol.
| Compound Name | [(1S,2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-sulfanylcyclopentyl]methanol |
|---|---|
| PubChem CID | 10938043 |
| Molecular Formula | C18H40O3SSi2 |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [(1S,2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-sulfanylcyclopentyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CO)C[C@H](S)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H40O3SSi2/c1-17(2,3)23(7,8)20-15-13(12-19)11-14(22)16(15)21-24(9,10)18(4,5)6/h13-16,19,22H,11-12H2,1-10H3/t13-,14-,15+,16-/m0/s1 |
| InChIKey | TWAVGBACAZAEJO-JONQDZQNSA-N |
| XLogP | 5.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|