C11H24O2Si — CID 69296261
[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol (PubChem CID 69296261) has the molecular formula C11H24O2Si and a molecular weight of 216.40 g/mol. Its IUPAC name is [(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol.
| Compound Name | [(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 69296261 |
| Molecular Formula | C11H24O2Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | [(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C[C@H]1CO |
| InChI | InChI=1S/C11H24O2Si/c1-11(2,3)14(4,5)13-8-10-6-9(10)7-12/h9-10,12H,6-8H2,1-5H3/t9-,10+/m0/s1 |
| InChIKey | PZQLNVLPDGTCOM-VHSXEESVSA-N |
| XLogP | 2.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|