C12H26O2Si — CID 11160591
[(1S,2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopropyl]methanol (PubChem CID 11160591) has the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. Its IUPAC name is [(1S,2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopropyl]methanol.
| Compound Name | [(1S,2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopropyl]methanol |
|---|---|
| PubChem CID | 11160591 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | [(1S,2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopropyl]methanol |
| SMILES | C[C@H]1[C@H](CO)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26O2Si/c1-9-10(7-13)11(9)8-14-15(5,6)12(2,3)4/h9-11,13H,7-8H2,1-6H3/t9-,10-,11-/m0/s1 |
| InChIKey | KALIFRKQTNPICL-DCAQKATOSA-N |
| XLogP | 2.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|