C13H26O3Si — CID 10753716
cis-(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)cyclopentan-1-one (PubChem CID 10753716) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is cis-(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)cyclopentan-1-one.
| Compound Name | cis-(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 10753716 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | cis-(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)cyclopentan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC(=O)C[C@H]1CO |
| InChI | InChI=1S/C13H26O3Si/c1-13(2,3)17(4,5)16-9-11-7-12(15)6-10(11)8-14/h10-11,14H,6-9H2,1-5H3/t10-,11+/m0/s1 |
| InChIKey | PHTPYTSAGSDFHC-WDEREUQCSA-N |
| XLogP | 2.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|