C12H24O3Si — CID 11096852
cis-(3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexan-1-one (PubChem CID 11096852) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is cis-(3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexan-1-one.
| Compound Name | cis-(3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 11096852 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | cis-(3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)C[C@@H](O)C1 |
| InChI | InChI=1S/C12H24O3Si/c1-12(2,3)16(4,5)15-11-7-9(13)6-10(14)8-11/h9,11,13H,6-8H2,1-5H3/t9-,11-/m1/s1 |
| InChIKey | FKRONZDHSWPFML-MWLCHTKSSA-N |
| XLogP | 2.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|