C12H24O4Si — CID 11288440
(2S,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxycyclohexan-1-one (PubChem CID 11288440) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is (2S,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxycyclohexan-1-one.
| Compound Name | (2S,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 11288440 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2S,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxycyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(=O)[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C12H24O4Si/c1-12(2,3)17(4,5)16-8-6-9(13)11(15)10(14)7-8/h8-9,11,13,15H,6-7H2,1-5H3/t8-,9-,11-/m0/s1 |
| InChIKey | BBBKLYSZRXQXDC-QXEWZRGKSA-N |
| XLogP | 1.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|